C24H29N7O2 — CID 71522708
3-ethyl-4-[8-(1H-indol-4-yl)-6-(3-methylmorpholin-4-yl)-7H-purin-2-yl]morpholine (PubChem CID 71522708) has the molecular formula C24H29N7O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 3-ethyl-4-[8-(1H-indol-4-yl)-6-(3-methylmorpholin-4-yl)-7H-purin-2-yl]morpholine.
| Compound Name | 3-ethyl-4-[8-(1H-indol-4-yl)-6-(3-methylmorpholin-4-yl)-7H-purin-2-yl]morpholine |
|---|---|
| PubChem CID | 71522708 |
| Molecular Formula | C24H29N7O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 3-ethyl-4-[8-(1H-indol-4-yl)-6-(3-methylmorpholin-4-yl)-7H-purin-2-yl]morpholine |
| SMILES | CCC1COCCN1c1nc(N2CCOCC2C)c2[nH]c(-c3cccc4[nH]ccc34)nc2n1 |
| InChI | InChI=1S/C24H29N7O2/c1-3-16-14-33-12-10-31(16)24-28-22-20(23(29-24)30-9-11-32-13-15(30)2)26-21(27-22)18-5-4-6-19-17(18)7-8-25-19/h4-8,15-16,25H,3,9-14H2,1-2H3,(H,26,27,28,29) |
| InChIKey | NOPRMGZBKIPBHY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |