C24H27N7O2 — CID 71522799
5-[8-(1H-indol-4-yl)-6-(3-methylmorpholin-4-yl)-7H-purin-2-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole (PubChem CID 71522799) has the molecular formula C24H27N7O2 and a molecular weight of 445.53 g/mol. Its IUPAC name is 5-[8-(1H-indol-4-yl)-6-(3-methylmorpholin-4-yl)-7H-purin-2-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole.
| Compound Name | 5-[8-(1H-indol-4-yl)-6-(3-methylmorpholin-4-yl)-7H-purin-2-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
|---|---|
| PubChem CID | 71522799 |
| Molecular Formula | C24H27N7O2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 5-[8-(1H-indol-4-yl)-6-(3-methylmorpholin-4-yl)-7H-purin-2-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
| SMILES | CC1COCCN1c1nc(N2CC3COCC3C2)nc2nc(-c3cccc4[nH]ccc34)[nH]c12 |
| InChI | InChI=1S/C24H27N7O2/c1-14-11-32-8-7-31(14)23-20-22(28-24(29-23)30-9-15-12-33-13-16(15)10-30)27-21(26-20)18-3-2-4-19-17(18)5-6-25-19/h2-6,14-16,25H,7-13H2,1H3,(H,26,27,28,29) |
| InChIKey | RMEKIIKTXNLDHE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |