C20H26F3N3O5 — CID 71523004
oxalic acid;1-[3-[2-[(3R)-3-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]ethyl]-2-pyridinyl]piperidin-2-one (PubChem CID 71523004) has the molecular formula C20H26F3N3O5 and a molecular weight of 445.44 g/mol. Its IUPAC name is oxalic acid;1-[3-[2-[(3R)-3-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]ethyl]-2-pyridinyl]piperidin-2-one.
| Compound Name | oxalic acid;1-[3-[2-[(3R)-3-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]ethyl]-2-pyridinyl]piperidin-2-one |
|---|---|
| PubChem CID | 71523004 |
| Molecular Formula | C20H26F3N3O5 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | oxalic acid;1-[3-[2-[(3R)-3-(2,2,2-trifluoroethyl)pyrrolidin-1-yl]ethyl]-2-pyridinyl]piperidin-2-one |
| SMILES | O=C(O)C(=O)O.O=C1CCCCN1c1ncccc1CCN1CC[C@H](CC(F)(F)F)C1 |
| InChI | InChI=1S/C18H24F3N3O.C2H2O4/c19-18(20,21)12-14-6-10-23(13-14)11-7-15-4-3-8-22-17(15)24-9-2-1-5-16(24)25;3-1(4)2(5)6/h3-4,8,14H,1-2,5-7,9-13H2;(H,3,4)(H,5,6)/t14-;/m1./s1 |
| InChIKey | QJGNVIBPCBRILN-PFEQFJNWSA-N |
| XLogP | 2.57 |
| TPSA | 111.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|