C25H33ClN2O4 — CID 71523793
(5S)-5-[5-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)pentylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one;hydrochloride (PubChem CID 71523793) has the molecular formula C25H33ClN2O4 and a molecular weight of 461.00 g/mol. Its IUPAC name is (5S)-5-[5-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)pentylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one;hydrochloride.
| Compound Name | (5S)-5-[5-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)pentylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one;hydrochloride |
|---|---|
| PubChem CID | 71523793 |
| Molecular Formula | C25H33ClN2O4 |
| Molecular Weight | 461.00 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | (5S)-5-[5-(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)pentylamino]-5,6,7,8-tetrahydro-1H-quinolin-2-one;hydrochloride |
| SMILES | COc1cc2c(cc1OC)C(=O)C(CCCCCN[C@H]1CCCc3[nH]c(=O)ccc31)C2.Cl |
| InChI | InChI=1S/C25H32N2O4.ClH/c1-30-22-14-17-13-16(25(29)19(17)15-23(22)31-2)7-4-3-5-12-26-20-8-6-9-21-18(20)10-11-24(28)27-21;/h10-11,14-16,20,26H,3-9,12-13H2,1-2H3,(H,27,28);1H/t16?,20-;/m0./s1 |
| InChIKey | IELBTFNTRVSQHW-NEXUVNJBSA-N |
| XLogP | 4.40 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.00 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|