C15H18O4 — CID 71524337
(5aS,9aS)-6,6,9a-trimethyl-5a,7,8,9-tetrahydro-4H-benzo[e][2]benzofuran-1,3,5-trione (PubChem CID 71524337) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is (5aS,9aS)-6,6,9a-trimethyl-5a,7,8,9-tetrahydro-4H-benzo[e][2]benzofuran-1,3,5-trione.
| Compound Name | (5aS,9aS)-6,6,9a-trimethyl-5a,7,8,9-tetrahydro-4H-benzo[e][2]benzofuran-1,3,5-trione |
|---|---|
| PubChem CID | 71524337 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (5aS,9aS)-6,6,9a-trimethyl-5a,7,8,9-tetrahydro-4H-benzo[e][2]benzofuran-1,3,5-trione |
| SMILES | CC1(C)CCC[C@]2(C)C3=C(CC(=O)[C@@H]12)C(=O)OC3=O |
| InChI | InChI=1S/C15H18O4/c1-14(2)5-4-6-15(3)10-8(7-9(16)11(14)15)12(17)19-13(10)18/h11H,4-7H2,1-3H3/t11-,15+/m0/s1 |
| InChIKey | PVFDLKUZKZFKON-XHDPSFHLSA-N |
| XLogP | 2.17 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|