C18H16ClNO2 — CID 71524522
(3aR,5R)-5-(4-chlorophenyl)-2,3,3a,5-tetrahydro-1H-pyrrolo[2,1-c][2,4]benzoxazepin-10-one (PubChem CID 71524522) has the molecular formula C18H16ClNO2 and a molecular weight of 313.78 g/mol. Its IUPAC name is (3aR,5R)-5-(4-chlorophenyl)-2,3,3a,5-tetrahydro-1H-pyrrolo[2,1-c][2,4]benzoxazepin-10-one.
| Compound Name | (3aR,5R)-5-(4-chlorophenyl)-2,3,3a,5-tetrahydro-1H-pyrrolo[2,1-c][2,4]benzoxazepin-10-one |
|---|---|
| PubChem CID | 71524522 |
| Molecular Formula | C18H16ClNO2 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (3aR,5R)-5-(4-chlorophenyl)-2,3,3a,5-tetrahydro-1H-pyrrolo[2,1-c][2,4]benzoxazepin-10-one |
| SMILES | O=C1c2ccccc2[C@@H](c2ccc(Cl)cc2)O[C@@H]2CCCN12 |
| InChI | InChI=1S/C18H16ClNO2/c19-13-9-7-12(8-10-13)17-14-4-1-2-5-15(14)18(21)20-11-3-6-16(20)22-17/h1-2,4-5,7-10,16-17H,3,6,11H2/t16-,17-/m1/s1 |
| InChIKey | FMVNLVRGYKAOGN-IAGOWNOFSA-N |
| XLogP | 4.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |