C27H28N4O3 — CID 71525926
4-[[2,2-dimethyl-3-[(2-methylimidazol-1-yl)methyl]-4-oxo-1,3-dihydrocarbazol-9-yl]methyl]-N-hydroxybenzamide (PubChem CID 71525926) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is 4-[[2,2-dimethyl-3-[(2-methylimidazol-1-yl)methyl]-4-oxo-1,3-dihydrocarbazol-9-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[2,2-dimethyl-3-[(2-methylimidazol-1-yl)methyl]-4-oxo-1,3-dihydrocarbazol-9-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 71525926 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 4-[[2,2-dimethyl-3-[(2-methylimidazol-1-yl)methyl]-4-oxo-1,3-dihydrocarbazol-9-yl]methyl]-N-hydroxybenzamide |
| SMILES | Cc1nccn1CC1C(=O)c2c(n(Cc3ccc(C(=O)NO)cc3)c3ccccc23)CC1(C)C |
| InChI | InChI=1S/C27H28N4O3/c1-17-28-12-13-30(17)16-21-25(32)24-20-6-4-5-7-22(20)31(23(24)14-27(21,2)3)15-18-8-10-19(11-9-18)26(33)29-34/h4-13,21,34H,14-16H2,1-3H3,(H,29,33) |
| InChIKey | GZVWWUFJCWQXJJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|