C27H31N3O5 — CID 70081336
but-2-enedioic acid;9-(cyclopentylmethyl)-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-one (PubChem CID 70081336) has the molecular formula C27H31N3O5 and a molecular weight of 477.56 g/mol. Its IUPAC name is but-2-enedioic acid;9-(cyclopentylmethyl)-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-one.
| Compound Name | but-2-enedioic acid;9-(cyclopentylmethyl)-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-one |
|---|---|
| PubChem CID | 70081336 |
| Molecular Formula | C27H31N3O5 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | but-2-enedioic acid;9-(cyclopentylmethyl)-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-one |
| SMILES | Cc1nccn1CC1CCc2c(c3ccccc3n2CC2CCCC2)C1=O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C23H27N3O.C4H4O4/c1-16-24-12-13-25(16)15-18-10-11-21-22(23(18)27)19-8-4-5-9-20(19)26(21)14-17-6-2-3-7-17;5-3(6)1-2-4(7)8/h4-5,8-9,12-13,17-18H,2-3,6-7,10-11,14-15H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | JLFRNSDILPDKBB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|