C22H25N3O4 — CID 69351868
but-2-enedioic acid;9-methyl-3-[(2-methylimidazol-1-yl)methyl]-1,2,3,4-tetrahydrocarbazole (PubChem CID 69351868) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is but-2-enedioic acid;9-methyl-3-[(2-methylimidazol-1-yl)methyl]-1,2,3,4-tetrahydrocarbazole.
| Compound Name | but-2-enedioic acid;9-methyl-3-[(2-methylimidazol-1-yl)methyl]-1,2,3,4-tetrahydrocarbazole |
|---|---|
| PubChem CID | 69351868 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | but-2-enedioic acid;9-methyl-3-[(2-methylimidazol-1-yl)methyl]-1,2,3,4-tetrahydrocarbazole |
| SMILES | Cc1nccn1CC1CCc2c(c3ccccc3n2C)C1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H21N3.C4H4O4/c1-13-19-9-10-21(13)12-14-7-8-18-16(11-14)15-5-3-4-6-17(15)20(18)2;5-3(6)1-2-4(7)8/h3-6,9-10,14H,7-8,11-12H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | IOLDYYFAUYAFCO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|