C25H24N4OS — CID 73218659
O-[[9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-ylidene]amino] benzenecarbothioate (PubChem CID 73218659) has the molecular formula C25H24N4OS and a molecular weight of 428.56 g/mol. Its IUPAC name is O-[[9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-ylidene]amino] benzenecarbothioate.
| Compound Name | O-[[9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-ylidene]amino] benzenecarbothioate |
|---|---|
| PubChem CID | 73218659 |
| Molecular Formula | C25H24N4OS |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | O-[[9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-ylidene]amino] benzenecarbothioate |
| SMILES | Cc1nccn1CC1CCc2c(c3ccccc3n2C)C1=NOC(=S)c1ccccc1 |
| InChI | InChI=1S/C25H24N4OS/c1-17-26-14-15-29(17)16-19-12-13-22-23(20-10-6-7-11-21(20)28(22)2)24(19)27-30-25(31)18-8-4-3-5-9-18/h3-11,14-15,19H,12-13,16H2,1-2H3 |
| InChIKey | GVAOAOXNHQFVCX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|