C24H21ClF3N5O — CID 76601200
N-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-imine (PubChem CID 76601200) has the molecular formula C24H21ClF3N5O and a molecular weight of 487.91 g/mol. Its IUPAC name is N-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-imine.
| Compound Name | N-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-imine |
|---|---|
| PubChem CID | 76601200 |
| Molecular Formula | C24H21ClF3N5O |
| Molecular Weight | 487.91 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | N-[[6-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-imine |
| SMILES | Cc1nccn1CC1CCc2c(c3ccccc3n2C)C1=NOc1ccc(C(F)(F)F)c(Cl)n1 |
| InChI | InChI=1S/C24H21ClF3N5O/c1-14-29-11-12-33(14)13-15-7-9-19-21(16-5-3-4-6-18(16)32(19)2)22(15)31-34-20-10-8-17(23(25)30-20)24(26,27)28/h3-6,8,10-12,15H,7,9,13H2,1-2H3 |
| InChIKey | KXIHCCZZVOCNHP-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.91 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|