C24H27CaN3O9 — CID 69305514
calcium;9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-one;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanedioate (PubChem CID 69305514) has the molecular formula C24H27CaN3O9 and a molecular weight of 541.57 g/mol. Its IUPAC name is calcium;9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-one;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanedioate.
| Compound Name | calcium;9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-one;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanedioate |
|---|---|
| PubChem CID | 69305514 |
| Molecular Formula | C24H27CaN3O9 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | calcium;9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-one;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanedioate |
| SMILES | Cc1nccn1CC1CCc2c(c3ccccc3n2C)C1=O.O=C([O-])[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C18H19N3O.C6H10O8.Ca/c1-12-19-9-10-21(12)11-13-7-8-16-17(18(13)22)14-5-3-4-6-15(14)20(16)2;7-1(3(9)5(11)12)2(8)4(10)6(13)14;/h3-6,9-10,13H,7-8,11H2,1-2H3;1-4,7-10H,(H,11,12)(H,13,14);/q;;+2/p-2/t;1-,2-,3-,4+;/m.0./s1 |
| InChIKey | BWDZRLXPQMLPPD-VGOMBLBXSA-L |
| XLogP | -3.32 |
| TPSA | 201.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |