C30H31N5O4 — CID 68985032
5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione;9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-one (PubChem CID 68985032) has the molecular formula C30H31N5O4 and a molecular weight of 525.61 g/mol. Its IUPAC name is 5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione;9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-one.
| Compound Name | 5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione;9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-one |
|---|---|
| PubChem CID | 68985032 |
| Molecular Formula | C30H31N5O4 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | 5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione;9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-one |
| SMILES | CCC1(c2ccccc2)C(=O)NC(=O)NC1=O.Cc1nccn1CC1CCc2c(c3ccccc3n2C)C1=O |
| InChI | InChI=1S/C18H19N3O.C12H12N2O3/c1-12-19-9-10-21(12)11-13-7-8-16-17(18(13)22)14-5-3-4-6-15(14)20(16)2;1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16/h3-6,9-10,13H,7-8,11H2,1-2H3;3-7H,2H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | AFLRKQZQGWBDDF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|