C27H31N3O5 — CID 14233908
(Z)-but-2-enedioic acid;9-(cyclopentylmethyl)-3-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3-dihydro-1H-carbazol-4-one (PubChem CID 14233908) has the molecular formula C27H31N3O5 and a molecular weight of 477.56 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;9-(cyclopentylmethyl)-3-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3-dihydro-1H-carbazol-4-one.
| Compound Name | (Z)-but-2-enedioic acid;9-(cyclopentylmethyl)-3-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3-dihydro-1H-carbazol-4-one |
|---|---|
| PubChem CID | 14233908 |
| Molecular Formula | C27H31N3O5 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | (Z)-but-2-enedioic acid;9-(cyclopentylmethyl)-3-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3-dihydro-1H-carbazol-4-one |
| SMILES | Cc1[nH]cnc1CC1CCc2c(c3ccccc3n2CC2CCCC2)C1=O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C23H27N3O.C4H4O4/c1-15-19(25-14-24-15)12-17-10-11-21-22(23(17)27)18-8-4-5-9-20(18)26(21)13-16-6-2-3-7-16;5-3(6)1-2-4(7)8/h4-5,8-9,14,16-17H,2-3,6-7,10-13H2,1H3,(H,24,25);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | NHGZDJJCAFXAIJ-BTJKTKAUSA-N |
| XLogP | 4.56 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|