C27H25N3O7S — CID 67885757
9-(benzenesulfonyl)-3-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3-dihydro-1H-carbazol-4-one;but-2-enedioic acid (PubChem CID 67885757) has the molecular formula C27H25N3O7S and a molecular weight of 535.58 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-3-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3-dihydro-1H-carbazol-4-one;but-2-enedioic acid.
| Compound Name | 9-(benzenesulfonyl)-3-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3-dihydro-1H-carbazol-4-one;but-2-enedioic acid |
|---|---|
| PubChem CID | 67885757 |
| Molecular Formula | C27H25N3O7S |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | 9-(benzenesulfonyl)-3-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3-dihydro-1H-carbazol-4-one;but-2-enedioic acid |
| SMILES | Cc1[nH]cnc1CC1CCc2c(c3ccccc3n2S(=O)(=O)c2ccccc2)C1=O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C23H21N3O3S.C4H4O4/c1-15-19(25-14-24-15)13-16-11-12-21-22(23(16)27)18-9-5-6-10-20(18)26(21)30(28,29)17-7-3-2-4-8-17;5-3(6)1-2-4(7)8/h2-10,14,16H,11-13H2,1H3,(H,24,25);1-2H,(H,5,6)(H,7,8) |
| InChIKey | RETKIGKCXWRDNY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 159.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|