C20H21N3O — CID 54372224
7-[(5-methyl-1H-imidazol-4-yl)methyl]-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraen-8-one (PubChem CID 54372224) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is 7-[(5-methyl-1H-imidazol-4-yl)methyl]-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraen-8-one.
| Compound Name | 7-[(5-methyl-1H-imidazol-4-yl)methyl]-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraen-8-one |
|---|---|
| PubChem CID | 54372224 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 7-[(5-methyl-1H-imidazol-4-yl)methyl]-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraen-8-one |
| SMILES | Cc1[nH]cnc1CC1CC2CCCn3c2c(c2ccccc23)C1=O |
| InChI | InChI=1S/C20H21N3O/c1-12-16(22-11-21-12)10-14-9-13-5-4-8-23-17-7-3-2-6-15(17)18(19(13)23)20(14)24/h2-3,6-7,11,13-14H,4-5,8-10H2,1H3,(H,21,22) |
| InChIKey | UTZSHUHZXKSUKQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |