C19H16BrN3O2S — CID 71530753
(10R,15R)-10-(5-bromothiophen-2-yl)-13-ethyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione (PubChem CID 71530753) has the molecular formula C19H16BrN3O2S and a molecular weight of 430.33 g/mol. Its IUPAC name is (10R,15R)-10-(5-bromothiophen-2-yl)-13-ethyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione.
| Compound Name | (10R,15R)-10-(5-bromothiophen-2-yl)-13-ethyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
|---|---|
| PubChem CID | 71530753 |
| Molecular Formula | C19H16BrN3O2S |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | (10R,15R)-10-(5-bromothiophen-2-yl)-13-ethyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
| SMILES | CCN1C(=O)[C@H]2Cc3c([nH]c4ccccc34)[C@H](c3ccc(Br)s3)N2C1=O |
| InChI | InChI=1S/C19H16BrN3O2S/c1-2-22-18(24)13-9-11-10-5-3-4-6-12(10)21-16(11)17(23(13)19(22)25)14-7-8-15(20)26-14/h3-8,13,17,21H,2,9H2,1H3/t13-,17+/m1/s1 |
| InChIKey | VJRFKHSBKSOGIJ-DYVFJYSZSA-N |
| XLogP | 4.29 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|