icosyl(methoxy)phosphinous acid

C21H45O2P — CID 71531002

IUPACicosyl(methoxy)phosphinous acid
SMILESCCCCCCCCCCCCCCCCCCCCP(O)OC
InChIInChI=1S/C21H45O2P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24(22)23-2/h22H,3-21H2,1-2H3
InChIKeyNOHVLQMYCQMHEC-UHFFFAOYSA-N
MW360.56 g/mol
LogP7.98
Rot. Bonds20

About icosyl(methoxy)phosphinous acid

icosyl(methoxy)phosphinous acid (PubChem CID 71531002) has the molecular formula C21H45O2P and a molecular weight of 360.56 g/mol. Its IUPAC name is icosyl(methoxy)phosphinous acid.

Molecular Properties

Compound Nameicosyl(methoxy)phosphinous acid
PubChem CID71531002
Molecular FormulaC21H45O2P
Molecular Weight360.56 g/mol
Exact Mass360.32
IUPAC Nameicosyl(methoxy)phosphinous acid
SMILESCCCCCCCCCCCCCCCCCCCCP(O)OC
InChIInChI=1S/C21H45O2P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24(22)23-2/h22H,3-21H2,1-2H3
InChIKeyNOHVLQMYCQMHEC-UHFFFAOYSA-N
XLogP7.98
TPSA29.46 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds20
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500360.56
LogP ≤ 57.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze icosyl(methoxy)phosphinous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of icosyl(methoxy)phosphinous acid?
The IUPAC name of icosyl(methoxy)phosphinous acid (CID 71531002) is icosyl(methoxy)phosphinous acid.
What is the SMILES notation for icosyl(methoxy)phosphinous acid?
The canonical SMILES for icosyl(methoxy)phosphinous acid is CCCCCCCCCCCCCCCCCCCCP(O)OC.
What is the InChIKey of icosyl(methoxy)phosphinous acid?
The InChIKey is NOHVLQMYCQMHEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H45O2P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24(22)23-2/h22H,3-21H2,1-2H3.
What are the key properties of icosyl(methoxy)phosphinous acid?
icosyl(methoxy)phosphinous acid has a molecular weight of 360.56 g/mol, XLogP of 7.98, 20 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for icosyl(methoxy)phosphinous acid is sourced from PubChem (CID 71531002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).