About azane;methyl hydrogen sulfate;trioctylphosphane
azane;methyl hydrogen sulfate;trioctylphosphane (PubChem CID 174431747) has the molecular formula C25H58NO4PS
and a molecular weight of 499.78 g/mol. Its IUPAC name is azane;methyl hydrogen sulfate;trioctylphosphane.
Molecular Properties
| Compound Name | azane;methyl hydrogen sulfate;trioctylphosphane |
| PubChem CID | 174431747 |
| Molecular Formula | C25H58NO4PS |
| Molecular Weight | 499.78 g/mol |
| Exact Mass | 499.38 |
| IUPAC Name | azane;methyl hydrogen sulfate;trioctylphosphane |
| SMILES | CCCCCCCCP(CCCCCCCC)CCCCCCCC.COS(=O)(=O)O.N |
| InChI | InChI=1S/C24H51P.CH4O4S.H3N/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-5-6(2,3)4;/h4-24H2,1-3H3;1H3,(H,2,3,4);1H3 |
| InChIKey | NFYUNNROMDAJSK-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 98.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.78 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;methyl hydrogen sulfate;trioctylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;methyl hydrogen sulfate;trioctylphosphane?
The IUPAC name of azane;methyl hydrogen sulfate;trioctylphosphane (CID 174431747) is azane;methyl hydrogen sulfate;trioctylphosphane.
What is the SMILES notation for azane;methyl hydrogen sulfate;trioctylphosphane?
The canonical SMILES for azane;methyl hydrogen sulfate;trioctylphosphane is CCCCCCCCP(CCCCCCCC)CCCCCCCC.COS(=O)(=O)O.N.
What is the InChIKey of azane;methyl hydrogen sulfate;trioctylphosphane?
The InChIKey is NFYUNNROMDAJSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51P.CH4O4S.H3N/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-5-6(2,3)4;/h4-24H2,1-3H3;1H3,(H,2,3,4);1H3.
What are the key properties of azane;methyl hydrogen sulfate;trioctylphosphane?
azane;methyl hydrogen sulfate;trioctylphosphane has a molecular weight of 499.78 g/mol, XLogP of 9.15, 22 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;methyl hydrogen sulfate;trioctylphosphane is sourced from PubChem (CID 174431747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).