About carbonic acid;trioctylphosphane
carbonic acid;trioctylphosphane (PubChem CID 174362126) has the molecular formula C25H53O3P
and a molecular weight of 432.67 g/mol. Its IUPAC name is carbonic acid;trioctylphosphane.
Molecular Properties
| Compound Name | carbonic acid;trioctylphosphane |
| PubChem CID | 174362126 |
| Molecular Formula | C25H53O3P |
| Molecular Weight | 432.67 g/mol |
| Exact Mass | 432.37 |
| IUPAC Name | carbonic acid;trioctylphosphane |
| SMILES | CCCCCCCCP(CCCCCCCC)CCCCCCCC.O=C(O)O |
| InChI | InChI=1S/C24H51P.CH2O3/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;2-1(3)4/h4-24H2,1-3H3;(H2,2,3,4) |
| InChIKey | LKQWBZOJUXXYIA-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.67 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;trioctylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;trioctylphosphane?
The IUPAC name of carbonic acid;trioctylphosphane (CID 174362126) is carbonic acid;trioctylphosphane.
What is the SMILES notation for carbonic acid;trioctylphosphane?
The canonical SMILES for carbonic acid;trioctylphosphane is CCCCCCCCP(CCCCCCCC)CCCCCCCC.O=C(O)O.
What is the InChIKey of carbonic acid;trioctylphosphane?
The InChIKey is LKQWBZOJUXXYIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51P.CH2O3/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;2-1(3)4/h4-24H2,1-3H3;(H2,2,3,4).
What are the key properties of carbonic acid;trioctylphosphane?
carbonic acid;trioctylphosphane has a molecular weight of 432.67 g/mol, XLogP of 9.77, 21 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;trioctylphosphane is sourced from PubChem (CID 174362126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).