About azane;ethanesulfonic acid;trioctylphosphane
azane;ethanesulfonic acid;trioctylphosphane (PubChem CID 174735782) has the molecular formula C26H60NO3PS
and a molecular weight of 497.81 g/mol. Its IUPAC name is azane;ethanesulfonic acid;trioctylphosphane.
Molecular Properties
| Compound Name | azane;ethanesulfonic acid;trioctylphosphane |
| PubChem CID | 174735782 |
| Molecular Formula | C26H60NO3PS |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 497.40 |
| IUPAC Name | azane;ethanesulfonic acid;trioctylphosphane |
| SMILES | CCCCCCCCP(CCCCCCCC)CCCCCCCC.CCS(=O)(=O)O.N |
| InChI | InChI=1S/C24H51P.C2H6O3S.H3N/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-2-6(3,4)5;/h4-24H2,1-3H3;2H2,1H3,(H,3,4,5);1H3 |
| InChIKey | BSXCZAAZKCSZPE-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;ethanesulfonic acid;trioctylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;ethanesulfonic acid;trioctylphosphane?
The IUPAC name of azane;ethanesulfonic acid;trioctylphosphane (CID 174735782) is azane;ethanesulfonic acid;trioctylphosphane.
What is the SMILES notation for azane;ethanesulfonic acid;trioctylphosphane?
The canonical SMILES for azane;ethanesulfonic acid;trioctylphosphane is CCCCCCCCP(CCCCCCCC)CCCCCCCC.CCS(=O)(=O)O.N.
What is the InChIKey of azane;ethanesulfonic acid;trioctylphosphane?
The InChIKey is BSXCZAAZKCSZPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51P.C2H6O3S.H3N/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-2-6(3,4)5;/h4-24H2,1-3H3;2H2,1H3,(H,3,4,5);1H3.
What are the key properties of azane;ethanesulfonic acid;trioctylphosphane?
azane;ethanesulfonic acid;trioctylphosphane has a molecular weight of 497.81 g/mol, XLogP of 9.61, 22 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;ethanesulfonic acid;trioctylphosphane is sourced from PubChem (CID 174735782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).