C14H24O3 — CID 71534370
(3S)-3-[(4R,5R,6S)-2,2,5-trimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]butan-2-one (PubChem CID 71534370) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (3S)-3-[(4R,5R,6S)-2,2,5-trimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]butan-2-one.
| Compound Name | (3S)-3-[(4R,5R,6S)-2,2,5-trimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]butan-2-one |
|---|---|
| PubChem CID | 71534370 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (3S)-3-[(4R,5R,6S)-2,2,5-trimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]butan-2-one |
| SMILES | C=CC[C@@H]1OC(C)(C)O[C@@H]([C@H](C)C(C)=O)[C@@H]1C |
| InChI | InChI=1S/C14H24O3/c1-7-8-12-10(3)13(9(2)11(4)15)17-14(5,6)16-12/h7,9-10,12-13H,1,8H2,2-6H3/t9-,10-,12+,13+/m1/s1 |
| InChIKey | BLNQMIQBTNXVLF-AAXDQBDMSA-N |
| XLogP | 2.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|