C19H22N4O2S — CID 71534433
1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-(6-morpholin-4-yl-4-sulfanylidene-1H-pyrimidin-2-yl)ethanone (PubChem CID 71534433) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is 1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-(6-morpholin-4-yl-4-sulfanylidene-1H-pyrimidin-2-yl)ethanone.
| Compound Name | 1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-(6-morpholin-4-yl-4-sulfanylidene-1H-pyrimidin-2-yl)ethanone |
|---|---|
| PubChem CID | 71534433 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-(6-morpholin-4-yl-4-sulfanylidene-1H-pyrimidin-2-yl)ethanone |
| SMILES | C[C@H]1Cc2ccccc2N1C(=O)Cc1nc(=S)cc(N2CCOCC2)[nH]1 |
| InChI | InChI=1S/C19H22N4O2S/c1-13-10-14-4-2-3-5-15(14)23(13)19(24)11-16-20-17(12-18(26)21-16)22-6-8-25-9-7-22/h2-5,12-13H,6-11H2,1H3,(H,20,21,26)/t13-/m0/s1 |
| InChIKey | QAKYIKOVPVVHEH-ZDUSSCGKSA-N |
| XLogP | 2.50 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|