C22H21F2N7O — CID 71534525
1-[4-(cyanomethyl)-1-(6-fluoro-2-pyridinyl)piperidin-4-yl]-3-(4-fluoroanilino)pyrazole-4-carboxamide (PubChem CID 71534525) has the molecular formula C22H21F2N7O and a molecular weight of 437.45 g/mol. Its IUPAC name is 1-[4-(cyanomethyl)-1-(6-fluoro-2-pyridinyl)piperidin-4-yl]-3-(4-fluoroanilino)pyrazole-4-carboxamide.
| Compound Name | 1-[4-(cyanomethyl)-1-(6-fluoro-2-pyridinyl)piperidin-4-yl]-3-(4-fluoroanilino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 71534525 |
| Molecular Formula | C22H21F2N7O |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 1-[4-(cyanomethyl)-1-(6-fluoro-2-pyridinyl)piperidin-4-yl]-3-(4-fluoroanilino)pyrazole-4-carboxamide |
| SMILES | N#CCC1(n2cc(C(N)=O)c(Nc3ccc(F)cc3)n2)CCN(c2cccc(F)n2)CC1 |
| InChI | InChI=1S/C22H21F2N7O/c23-15-4-6-16(7-5-15)27-21-17(20(26)32)14-31(29-21)22(8-11-25)9-12-30(13-10-22)19-3-1-2-18(24)28-19/h1-7,14H,8-10,12-13H2,(H2,26,32)(H,27,29) |
| InChIKey | VTMHIAYIDIGSRS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|