C15H15BrFNO3 — CID 71535438
methyl 3-[1-[(4-bromo-2-fluorophenyl)methyl]-5-oxo-2H-pyrrol-4-yl]propanoate (PubChem CID 71535438) has the molecular formula C15H15BrFNO3 and a molecular weight of 356.19 g/mol. Its IUPAC name is methyl 3-[1-[(4-bromo-2-fluorophenyl)methyl]-5-oxo-2H-pyrrol-4-yl]propanoate.
| Compound Name | methyl 3-[1-[(4-bromo-2-fluorophenyl)methyl]-5-oxo-2H-pyrrol-4-yl]propanoate |
|---|---|
| PubChem CID | 71535438 |
| Molecular Formula | C15H15BrFNO3 |
| Molecular Weight | 356.19 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | methyl 3-[1-[(4-bromo-2-fluorophenyl)methyl]-5-oxo-2H-pyrrol-4-yl]propanoate |
| SMILES | COC(=O)CCC1=CCN(Cc2ccc(Br)cc2F)C1=O |
| InChI | InChI=1S/C15H15BrFNO3/c1-21-14(19)5-3-10-6-7-18(15(10)20)9-11-2-4-12(16)8-13(11)17/h2,4,6,8H,3,5,7,9H2,1H3 |
| InChIKey | FSWBDWQDOVJWEZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.19 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |