C18H20ClFN6O — CID 71536117
3-(4-chloro-3-fluoroanilino)-1-[2-cyano-4-(methylamino)cyclohexyl]pyrazole-4-carboxamide (PubChem CID 71536117) has the molecular formula C18H20ClFN6O and a molecular weight of 390.85 g/mol. Its IUPAC name is 3-(4-chloro-3-fluoroanilino)-1-[2-cyano-4-(methylamino)cyclohexyl]pyrazole-4-carboxamide.
| Compound Name | 3-(4-chloro-3-fluoroanilino)-1-[2-cyano-4-(methylamino)cyclohexyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 71536117 |
| Molecular Formula | C18H20ClFN6O |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 3-(4-chloro-3-fluoroanilino)-1-[2-cyano-4-(methylamino)cyclohexyl]pyrazole-4-carboxamide |
| SMILES | CNC1CCC(n2cc(C(N)=O)c(Nc3ccc(Cl)c(F)c3)n2)C(C#N)C1 |
| InChI | InChI=1S/C18H20ClFN6O/c1-23-11-3-5-16(10(6-11)8-21)26-9-13(17(22)27)18(25-26)24-12-2-4-14(19)15(20)7-12/h2,4,7,9-11,16,23H,3,5-6H2,1H3,(H2,22,27)(H,24,25) |
| InChIKey | ZHYFSXYFQAYEQD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 108.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |