C22H32N2O9Pt+2 — CID 71537043
(1S,3R,4R,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid;platinum(2+);trans-(1R,2R)-cyclohexane-1,2-diamine (PubChem CID 71537043) has the molecular formula C22H32N2O9Pt+2 and a molecular weight of 663.58 g/mol. Its IUPAC name is (1S,3R,4R,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid;platinum(2+);trans-(1R,2R)-cyclohexane-1,2-diamine.
| Compound Name | (1S,3R,4R,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid;platinum(2+);trans-(1R,2R)-cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 71537043 |
| Molecular Formula | C22H32N2O9Pt+2 |
| Molecular Weight | 663.58 g/mol |
| Exact Mass | 663.17 |
| IUPAC Name | (1S,3R,4R,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylic acid;platinum(2+);trans-(1R,2R)-cyclohexane-1,2-diamine |
| SMILES | N[C@@H]1CCCC[C@H]1N.O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1C[C@](O)(C(=O)O)C[C@@H](O)[C@H]1O.[Pt+2] |
| InChI | InChI=1S/C16H18O9.C6H14N2.Pt/c17-9-3-1-8(5-10(9)18)2-4-13(20)25-12-7-16(24,15(22)23)6-11(19)14(12)21;7-5-3-1-2-4-6(5)8;/h1-5,11-12,14,17-19,21,24H,6-7H2,(H,22,23);5-6H,1-4,7-8H2;/q;;+2/b4-2+;;/t11-,12-,14-,16+;5-,6-;/m11./s1 |
| InChIKey | ZQJFEUDAPZNBSK-FSBDBSDHSA-N |
| XLogP | -0.43 |
| TPSA | 216.79 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.58 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|