C24H17N3O2 — CID 7154325
(11R)-11-(4-methoxyphenyl)-14-oxa-3,10,12-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2,4,6,8,12,15,17,19-nonaene (PubChem CID 7154325) has the molecular formula C24H17N3O2 and a molecular weight of 379.42 g/mol. Its IUPAC name is (11R)-11-(4-methoxyphenyl)-14-oxa-3,10,12-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2,4,6,8,12,15,17,19-nonaene.
| Compound Name | (11R)-11-(4-methoxyphenyl)-14-oxa-3,10,12-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2,4,6,8,12,15,17,19-nonaene |
|---|---|
| PubChem CID | 7154325 |
| Molecular Formula | C24H17N3O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | (11R)-11-(4-methoxyphenyl)-14-oxa-3,10,12-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2,4,6,8,12,15,17,19-nonaene |
| SMILES | COc1ccc([C@H]2N=C3Oc4ccccc4C=C3c3nc4ccccc4n32)cc1 |
| InChI | InChI=1S/C24H17N3O2/c1-28-17-12-10-15(11-13-17)22-26-24-18(14-16-6-2-5-9-21(16)29-24)23-25-19-7-3-4-8-20(19)27(22)23/h2-14,22H,1H3/t22-/m0/s1 |
| InChIKey | AXOPUKSVRSNDAE-QFIPXVFZSA-N |
| XLogP | 4.94 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |