C16H16N2O2 — CID 15528346
3-(4-methoxyphenyl)-2-methyl-5-phenyl-3H-1,2,4-oxadiazole (PubChem CID 15528346) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2-methyl-5-phenyl-3H-1,2,4-oxadiazole.
| Compound Name | 3-(4-methoxyphenyl)-2-methyl-5-phenyl-3H-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 15528346 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3-(4-methoxyphenyl)-2-methyl-5-phenyl-3H-1,2,4-oxadiazole |
| SMILES | COc1ccc(C2N=C(c3ccccc3)ON2C)cc1 |
| InChI | InChI=1S/C16H16N2O2/c1-18-15(12-8-10-14(19-2)11-9-12)17-16(20-18)13-6-4-3-5-7-13/h3-11,15H,1-2H3 |
| InChIKey | XZZMDYGLDPLLTO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |