C32H51ClO2 — CID 7154434
[(3S,8S,9R,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-chloro-2-methylbut-2-enoate (PubChem CID 7154434) has the molecular formula C32H51ClO2 and a molecular weight of 503.21 g/mol. Its IUPAC name is [(3S,8S,9R,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-chloro-2-methylbut-2-enoate.
| Compound Name | [(3S,8S,9R,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-chloro-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 7154434 |
| Molecular Formula | C32H51ClO2 |
| Molecular Weight | 503.21 g/mol |
| Exact Mass | 502.36 |
| IUPAC Name | [(3S,8S,9R,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-chloro-2-methylbut-2-enoate |
| SMILES | C/C(Cl)=C(/C)C(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@H]2CC[C@]2(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C32H51ClO2/c1-20(2)9-8-10-21(3)27-13-14-28-26-12-11-24-19-25(35-30(34)22(4)23(5)33)15-17-31(24,6)29(26)16-18-32(27,28)7/h11,20-21,25-29H,8-10,12-19H2,1-7H3/b23-22+/t21-,25+,26+,27-,28+,29-,31+,32-/m1/s1 |
| InChIKey | YFFTTWXZRLUZRK-MQWGUYPMSA-N |
| XLogP | 9.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.21 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|