C13H19NO4 — CID 71546050
(3S,3'R,8S,8aS)-3-(hydroxymethyl)-3'-methylspiro[1,2,3,6,7,8a-hexahydroindolizine-8,5'-oxolane]-2',5-dione (PubChem CID 71546050) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is (3S,3'R,8S,8aS)-3-(hydroxymethyl)-3'-methylspiro[1,2,3,6,7,8a-hexahydroindolizine-8,5'-oxolane]-2',5-dione.
| Compound Name | (3S,3'R,8S,8aS)-3-(hydroxymethyl)-3'-methylspiro[1,2,3,6,7,8a-hexahydroindolizine-8,5'-oxolane]-2',5-dione |
|---|---|
| PubChem CID | 71546050 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (3S,3'R,8S,8aS)-3-(hydroxymethyl)-3'-methylspiro[1,2,3,6,7,8a-hexahydroindolizine-8,5'-oxolane]-2',5-dione |
| SMILES | C[C@@H]1C[C@]2(CCC(=O)N3[C@H](CO)CC[C@H]32)OC1=O |
| InChI | InChI=1S/C13H19NO4/c1-8-6-13(18-12(8)17)5-4-11(16)14-9(7-15)2-3-10(13)14/h8-10,15H,2-7H2,1H3/t8-,9+,10+,13+/m1/s1 |
| InChIKey | USERBYPNRMACAB-QYTUQVAYSA-N |
| XLogP | 0.45 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |