C22H23FN4O — CID 71550071
US9650336, Example 2 (PubChem CID 71550071) has the molecular formula C22H23FN4O and a molecular weight of 378.45 g/mol.
| Compound Name | US9650336, Example 2 |
|---|---|
| PubChem CID | 71550071 |
| Molecular Formula | C22H23FN4O |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | — |
| SMILES | COC1CCC2(CC1)Cc1ccc(-c3cncnc3)cc1C21C=C(F)C(N)=N1 |
| InChI | InChI=1S/C22H23FN4O/c1-28-17-4-6-21(7-5-17)9-15-3-2-14(16-11-25-13-26-12-16)8-18(15)22(21)10-19(23)20(24)27-22/h2-3,8,10-13,17H,4-7,9H2,1H3,(H2,24,27) |
| InChIKey | XCPNTAGKJZPLCP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |