C27H34N4O2S — CID 71551448
(2S)-2-amino-N-[(1R)-2-[2-[5-(4-aminobutyl)thiophen-2-yl]ethylamino]-2-oxo-1-phenylethyl]-3-phenylpropanamide (PubChem CID 71551448) has the molecular formula C27H34N4O2S and a molecular weight of 478.66 g/mol. Its IUPAC name is (2S)-2-amino-N-[(1R)-2-[2-[5-(4-aminobutyl)thiophen-2-yl]ethylamino]-2-oxo-1-phenylethyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-[(1R)-2-[2-[5-(4-aminobutyl)thiophen-2-yl]ethylamino]-2-oxo-1-phenylethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 71551448 |
| Molecular Formula | C27H34N4O2S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | (2S)-2-amino-N-[(1R)-2-[2-[5-(4-aminobutyl)thiophen-2-yl]ethylamino]-2-oxo-1-phenylethyl]-3-phenylpropanamide |
| SMILES | NCCCCc1ccc(CCNC(=O)[C@H](NC(=O)[C@@H](N)Cc2ccccc2)c2ccccc2)s1 |
| InChI | InChI=1S/C27H34N4O2S/c28-17-8-7-13-22-14-15-23(34-22)16-18-30-27(33)25(21-11-5-2-6-12-21)31-26(32)24(29)19-20-9-3-1-4-10-20/h1-6,9-12,14-15,24-25H,7-8,13,16-19,28-29H2,(H,30,33)(H,31,32)/t24-,25+/m0/s1 |
| InChIKey | POORFDHUENGRMY-LOSJGSFVSA-N |
| XLogP | 3.12 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|