C13H18N2 — CID 71553655
1-N-[(1S,2R)-2-phenylcyclopropyl]cyclobutane-1,3-diamine (PubChem CID 71553655) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-N-[(1S,2R)-2-phenylcyclopropyl]cyclobutane-1,3-diamine.
| Compound Name | 1-N-[(1S,2R)-2-phenylcyclopropyl]cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 71553655 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-N-[(1S,2R)-2-phenylcyclopropyl]cyclobutane-1,3-diamine |
| SMILES | NC1CC(N[C@H]2C[C@@H]2c2ccccc2)C1 |
| InChI | InChI=1S/C13H18N2/c14-10-6-11(7-10)15-13-8-12(13)9-4-2-1-3-5-9/h1-5,10-13,15H,6-8,14H2/t10?,11?,12-,13+/m1/s1 |
| InChIKey | MDWANQHRPJNECZ-TUUUFIMRSA-N |
| XLogP | 1.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |