C12H27BN2O5 — CID 71554631
(2R)-2-amino-6-borono-2-[2-[ethyl(2-hydroxyethyl)amino]ethyl]hexanoic acid (PubChem CID 71554631) has the molecular formula C12H27BN2O5 and a molecular weight of 290.17 g/mol. Its IUPAC name is (2R)-2-amino-6-borono-2-[2-[ethyl(2-hydroxyethyl)amino]ethyl]hexanoic acid.
| Compound Name | (2R)-2-amino-6-borono-2-[2-[ethyl(2-hydroxyethyl)amino]ethyl]hexanoic acid |
|---|---|
| PubChem CID | 71554631 |
| Molecular Formula | C12H27BN2O5 |
| Molecular Weight | 290.17 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (2R)-2-amino-6-borono-2-[2-[ethyl(2-hydroxyethyl)amino]ethyl]hexanoic acid |
| SMILES | CCN(CCO)CC[C@](N)(CCCCB(O)O)C(=O)O |
| InChI | InChI=1S/C12H27BN2O5/c1-2-15(9-10-16)8-6-12(14,11(17)18)5-3-4-7-13(19)20/h16,19-20H,2-10,14H2,1H3,(H,17,18)/t12-/m1/s1 |
| InChIKey | FPYITPAXHJSSOY-GFCCVEGCSA-N |
| XLogP | -0.88 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.17 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|