C14H20O7 — CID 71555220
ethyl (E)-3-[(4R,5R)-5-[(1S)-1-acetyloxy-2-oxoethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 71555220) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is ethyl (E)-3-[(4R,5R)-5-[(1S)-1-acetyloxy-2-oxoethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(4R,5R)-5-[(1S)-1-acetyloxy-2-oxoethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 71555220 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | ethyl (E)-3-[(4R,5R)-5-[(1S)-1-acetyloxy-2-oxoethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1OC(C)(C)O[C@H]1[C@@H](C=O)OC(C)=O |
| InChI | InChI=1S/C14H20O7/c1-5-18-12(17)7-6-10-13(21-14(3,4)20-10)11(8-15)19-9(2)16/h6-8,10-11,13H,5H2,1-4H3/b7-6+/t10-,11-,13-/m1/s1 |
| InChIKey | KJNHAUJMFBRPBA-XFYHGXPUSA-N |
| XLogP | 0.76 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|