C24H27N3O3S — CID 71556526
2-[3-[[4-(4-methylsulfonylphenyl)phenoxy]methyl]azetidin-1-yl]-5-propylpyrimidine (PubChem CID 71556526) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is 2-[3-[[4-(4-methylsulfonylphenyl)phenoxy]methyl]azetidin-1-yl]-5-propylpyrimidine.
| Compound Name | 2-[3-[[4-(4-methylsulfonylphenyl)phenoxy]methyl]azetidin-1-yl]-5-propylpyrimidine |
|---|---|
| PubChem CID | 71556526 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 2-[3-[[4-(4-methylsulfonylphenyl)phenoxy]methyl]azetidin-1-yl]-5-propylpyrimidine |
| SMILES | CCCc1cnc(N2CC(COc3ccc(-c4ccc(S(C)(=O)=O)cc4)cc3)C2)nc1 |
| InChI | InChI=1S/C24H27N3O3S/c1-3-4-18-13-25-24(26-14-18)27-15-19(16-27)17-30-22-9-5-20(6-10-22)21-7-11-23(12-8-21)31(2,28)29/h5-14,19H,3-4,15-17H2,1-2H3 |
| InChIKey | SHLHGGOIXVPMIQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |