C21H17ClF3NO3 — CID 71556819
6-chloro-2-propan-2-yl-4-[[2-(trifluoromethoxy)phenyl]methyl]quinoline-3-carboxylic acid (PubChem CID 71556819) has the molecular formula C21H17ClF3NO3 and a molecular weight of 423.82 g/mol. Its IUPAC name is 6-chloro-2-propan-2-yl-4-[[2-(trifluoromethoxy)phenyl]methyl]quinoline-3-carboxylic acid.
| Compound Name | 6-chloro-2-propan-2-yl-4-[[2-(trifluoromethoxy)phenyl]methyl]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 71556819 |
| Molecular Formula | C21H17ClF3NO3 |
| Molecular Weight | 423.82 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 6-chloro-2-propan-2-yl-4-[[2-(trifluoromethoxy)phenyl]methyl]quinoline-3-carboxylic acid |
| SMILES | CC(C)c1nc2ccc(Cl)cc2c(Cc2ccccc2OC(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C21H17ClF3NO3/c1-11(2)19-18(20(27)28)15(14-10-13(22)7-8-16(14)26-19)9-12-5-3-4-6-17(12)29-21(23,24)25/h3-8,10-11H,9H2,1-2H3,(H,27,28) |
| InChIKey | ZNSPKNPHWWYISL-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.82 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |