C23H23Cl2NO3 — CID 86683014
ethyl 6-chloro-4-[(2-chlorophenyl)methyl]-8-methoxy-2-propan-2-ylquinoline-3-carboxylate (PubChem CID 86683014) has the molecular formula C23H23Cl2NO3 and a molecular weight of 432.35 g/mol. Its IUPAC name is ethyl 6-chloro-4-[(2-chlorophenyl)methyl]-8-methoxy-2-propan-2-ylquinoline-3-carboxylate.
| Compound Name | ethyl 6-chloro-4-[(2-chlorophenyl)methyl]-8-methoxy-2-propan-2-ylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 86683014 |
| Molecular Formula | C23H23Cl2NO3 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | ethyl 6-chloro-4-[(2-chlorophenyl)methyl]-8-methoxy-2-propan-2-ylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(C)C)nc2c(OC)cc(Cl)cc2c1Cc1ccccc1Cl |
| InChI | InChI=1S/C23H23Cl2NO3/c1-5-29-23(27)20-16(10-14-8-6-7-9-18(14)25)17-11-15(24)12-19(28-4)22(17)26-21(20)13(2)3/h6-9,11-13H,5,10H2,1-4H3 |
| InChIKey | ZGIYTAWTJRLNKL-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |