C24H24Cl2N2O2 — CID 86683022
ethyl 6-chloro-4-[(2-chlorophenyl)methyl]-2-piperidin-1-ylquinoline-3-carboxylate (PubChem CID 86683022) has the molecular formula C24H24Cl2N2O2 and a molecular weight of 443.37 g/mol. Its IUPAC name is ethyl 6-chloro-4-[(2-chlorophenyl)methyl]-2-piperidin-1-ylquinoline-3-carboxylate.
| Compound Name | ethyl 6-chloro-4-[(2-chlorophenyl)methyl]-2-piperidin-1-ylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 86683022 |
| Molecular Formula | C24H24Cl2N2O2 |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | ethyl 6-chloro-4-[(2-chlorophenyl)methyl]-2-piperidin-1-ylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(N2CCCCC2)nc2ccc(Cl)cc2c1Cc1ccccc1Cl |
| InChI | InChI=1S/C24H24Cl2N2O2/c1-2-30-24(29)22-19(14-16-8-4-5-9-20(16)26)18-15-17(25)10-11-21(18)27-23(22)28-12-6-3-7-13-28/h4-5,8-11,15H,2-3,6-7,12-14H2,1H3 |
| InChIKey | HXAUNLQDSOAOCU-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |