C12H12F3N5O2 — CID 71557931
N-pyrimidin-4-yl-5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentanamide (PubChem CID 71557931) has the molecular formula C12H12F3N5O2 and a molecular weight of 315.25 g/mol. Its IUPAC name is N-pyrimidin-4-yl-5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentanamide.
| Compound Name | N-pyrimidin-4-yl-5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentanamide |
|---|---|
| PubChem CID | 71557931 |
| Molecular Formula | C12H12F3N5O2 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-pyrimidin-4-yl-5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]pentanamide |
| SMILES | O=C(CCCCc1noc(C(F)(F)F)n1)Nc1ccncn1 |
| InChI | InChI=1S/C12H12F3N5O2/c13-12(14,15)11-19-9(20-22-11)3-1-2-4-10(21)18-8-5-6-16-7-17-8/h5-7H,1-4H2,(H,16,17,18,21) |
| InChIKey | RBHXEIWUOOWLNW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|