C23H31NO4 — CID 71559704
ethyl (E,4S,5S,8E)-4-hydroxy-5-methyl-7-oxo-8-[1-(1-phenylethyl)pyrrolidin-2-ylidene]oct-2-enoate (PubChem CID 71559704) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is ethyl (E,4S,5S,8E)-4-hydroxy-5-methyl-7-oxo-8-[1-(1-phenylethyl)pyrrolidin-2-ylidene]oct-2-enoate.
| Compound Name | ethyl (E,4S,5S,8E)-4-hydroxy-5-methyl-7-oxo-8-[1-(1-phenylethyl)pyrrolidin-2-ylidene]oct-2-enoate |
|---|---|
| PubChem CID | 71559704 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | ethyl (E,4S,5S,8E)-4-hydroxy-5-methyl-7-oxo-8-[1-(1-phenylethyl)pyrrolidin-2-ylidene]oct-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](O)[C@@H](C)CC(=O)/C=C1\CCCN1C(C)c1ccccc1 |
| InChI | InChI=1S/C23H31NO4/c1-4-28-23(27)13-12-22(26)17(2)15-21(25)16-20-11-8-14-24(20)18(3)19-9-6-5-7-10-19/h5-7,9-10,12-13,16-18,22,26H,4,8,11,14-15H2,1-3H3/b13-12+,20-16+/t17-,18?,22+/m0/s1 |
| InChIKey | ZKWJXWOGUMIQSJ-ZTNWDWMBSA-N |
| XLogP | 3.80 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|