C22H25NO2 — CID 10592914
ethyl (2E)-2-phenyl-2-[1-[(1R)-1-phenylethyl]pyrrolidin-2-ylidene]acetate (PubChem CID 10592914) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is ethyl (2E)-2-phenyl-2-[1-[(1R)-1-phenylethyl]pyrrolidin-2-ylidene]acetate.
| Compound Name | ethyl (2E)-2-phenyl-2-[1-[(1R)-1-phenylethyl]pyrrolidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 10592914 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | ethyl (2E)-2-phenyl-2-[1-[(1R)-1-phenylethyl]pyrrolidin-2-ylidene]acetate |
| SMILES | CCOC(=O)/C(=C1\CCCN1[C@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO2/c1-3-25-22(24)21(19-13-8-5-9-14-19)20-15-10-16-23(20)17(2)18-11-6-4-7-12-18/h4-9,11-14,17H,3,10,15-16H2,1-2H3/b21-20+/t17-/m1/s1 |
| InChIKey | NBSIVHFGQLEMPT-SGRLSNSRSA-N |
| XLogP | 4.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|