C19H25NO4 — CID 10568492
dimethyl (2E)-2-[1-[(1R)-1-phenylethyl]pyrrolidin-2-ylidene]pentanedioate (PubChem CID 10568492) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is dimethyl (2E)-2-[1-[(1R)-1-phenylethyl]pyrrolidin-2-ylidene]pentanedioate.
| Compound Name | dimethyl (2E)-2-[1-[(1R)-1-phenylethyl]pyrrolidin-2-ylidene]pentanedioate |
|---|---|
| PubChem CID | 10568492 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | dimethyl (2E)-2-[1-[(1R)-1-phenylethyl]pyrrolidin-2-ylidene]pentanedioate |
| SMILES | COC(=O)CC/C(C(=O)OC)=C1/CCCN1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C19H25NO4/c1-14(15-8-5-4-6-9-15)20-13-7-10-17(20)16(19(22)24-3)11-12-18(21)23-2/h4-6,8-9,14H,7,10-13H2,1-3H3/b17-16+/t14-/m1/s1 |
| InChIKey | XVHSPQIYKXINRG-UVTIVQHFSA-N |
| XLogP | 3.22 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|