C23H27NO2 — CID 11624457
methyl (2Z)-3-phenyl-2-[1-[(1S)-1-phenylethyl]piperidin-2-ylidene]propanoate (PubChem CID 11624457) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is methyl (2Z)-3-phenyl-2-[1-[(1S)-1-phenylethyl]piperidin-2-ylidene]propanoate.
| Compound Name | methyl (2Z)-3-phenyl-2-[1-[(1S)-1-phenylethyl]piperidin-2-ylidene]propanoate |
|---|---|
| PubChem CID | 11624457 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | methyl (2Z)-3-phenyl-2-[1-[(1S)-1-phenylethyl]piperidin-2-ylidene]propanoate |
| SMILES | COC(=O)/C(Cc1ccccc1)=C1/CCCCN1[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C23H27NO2/c1-18(20-13-7-4-8-14-20)24-16-10-9-15-22(24)21(23(25)26-2)17-19-11-5-3-6-12-19/h3-8,11-14,18H,9-10,15-17H2,1-2H3/b22-21-/t18-/m0/s1 |
| InChIKey | WJPUQSSVOWJJAP-ZREAOVPFSA-N |
| XLogP | 4.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|