C13H22O2 — CID 71559946
methyl 2-[(1R,2S,5S)-5-methyl-2-prop-1-en-2-ylcyclohexyl]acetate (PubChem CID 71559946) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is methyl 2-[(1R,2S,5S)-5-methyl-2-prop-1-en-2-ylcyclohexyl]acetate.
| Compound Name | methyl 2-[(1R,2S,5S)-5-methyl-2-prop-1-en-2-ylcyclohexyl]acetate |
|---|---|
| PubChem CID | 71559946 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | methyl 2-[(1R,2S,5S)-5-methyl-2-prop-1-en-2-ylcyclohexyl]acetate |
| SMILES | C=C(C)[C@H]1CC[C@H](C)C[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C13H22O2/c1-9(2)12-6-5-10(3)7-11(12)8-13(14)15-4/h10-12H,1,5-8H2,2-4H3/t10-,11+,12+/m0/s1 |
| InChIKey | SBNJOBVEDOYRHK-QJPTWQEYSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|