C24H25N3O3S — CID 71560810
6-[4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenoxy]pyridine-3-carbothioamide (PubChem CID 71560810) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is 6-[4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenoxy]pyridine-3-carbothioamide.
| Compound Name | 6-[4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenoxy]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 71560810 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 6-[4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]phenoxy]pyridine-3-carbothioamide |
| SMILES | COc1cc2c(cc1OC)CN(Cc1ccc(Oc3ccc(C(N)=S)cn3)cc1)CC2 |
| InChI | InChI=1S/C24H25N3O3S/c1-28-21-11-17-9-10-27(15-19(17)12-22(21)29-2)14-16-3-6-20(7-4-16)30-23-8-5-18(13-26-23)24(25)31/h3-8,11-13H,9-10,14-15H2,1-2H3,(H2,25,31) |
| InChIKey | XWMYZOKMVRXHDO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 69.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|