C22H28N2O4S2 — CID 71561564
2-[[(4R,4aR,7aR,12bS)-9-methoxy-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-5-yl]sulfanyl]-N-(2-sulfanylethyl)acetamide (PubChem CID 71561564) has the molecular formula C22H28N2O4S2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 2-[[(4R,4aR,7aR,12bS)-9-methoxy-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-5-yl]sulfanyl]-N-(2-sulfanylethyl)acetamide.
| Compound Name | 2-[[(4R,4aR,7aR,12bS)-9-methoxy-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-5-yl]sulfanyl]-N-(2-sulfanylethyl)acetamide |
|---|---|
| PubChem CID | 71561564 |
| Molecular Formula | C22H28N2O4S2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 2-[[(4R,4aR,7aR,12bS)-9-methoxy-3-methyl-7-oxo-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-5-yl]sulfanyl]-N-(2-sulfanylethyl)acetamide |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)CC(SCC(=O)NCCS)[C@H]4[C@@H](C2)N(C)CC[C@]314 |
| InChI | InChI=1S/C22H28N2O4S2/c1-24-7-5-22-18-12-3-4-15(27-2)20(18)28-21(22)14(25)10-16(19(22)13(24)9-12)30-11-17(26)23-6-8-29/h3-4,13,16,19,21,29H,5-11H2,1-2H3,(H,23,26)/t13-,16?,19-,21+,22-/m1/s1 |
| InChIKey | BVBJOWXQOPLOLU-PEECRTGBSA-N |
| XLogP | 1.69 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|