C18H22O2S — CID 71561951
1,3,5-trimethyl-2-(2,4,5-trimethylphenyl)sulfonylbenzene (PubChem CID 71561951) has the molecular formula C18H22O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-(2,4,5-trimethylphenyl)sulfonylbenzene.
| Compound Name | 1,3,5-trimethyl-2-(2,4,5-trimethylphenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 71561951 |
| Molecular Formula | C18H22O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1,3,5-trimethyl-2-(2,4,5-trimethylphenyl)sulfonylbenzene |
| SMILES | Cc1cc(C)c(S(=O)(=O)c2cc(C)c(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C18H22O2S/c1-11-7-15(5)18(16(6)8-11)21(19,20)17-10-13(3)12(2)9-14(17)4/h7-10H,1-6H3 |
| InChIKey | QXJITWIQGAXQPU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |