C12H15ClN6O2 — CID 71563613
1-[5-(chloromethyl)-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperidine-4-carboxamide (PubChem CID 71563613) has the molecular formula C12H15ClN6O2 and a molecular weight of 310.75 g/mol. Its IUPAC name is 1-[5-(chloromethyl)-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[5-(chloromethyl)-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 71563613 |
| Molecular Formula | C12H15ClN6O2 |
| Molecular Weight | 310.75 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-[5-(chloromethyl)-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2nc3nc(CCl)cc(=O)n3[nH]2)CC1 |
| InChI | InChI=1S/C12H15ClN6O2/c13-6-8-5-9(20)19-11(15-8)16-12(17-19)18-3-1-7(2-4-18)10(14)21/h5,7H,1-4,6H2,(H2,14,21)(H,15,16,17) |
| InChIKey | ZQBJJADDLQULLA-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.75 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|